C8H6N3NaOS — CID 135050931
sodium 2,2-dicyano-1-(cyclopropanecarbonylamino)ethenethiolate (PubChem CID 135050931) has the molecular formula C8H6N3NaOS and a molecular weight of 215.21 g/mol. Its IUPAC name is sodium 2,2-dicyano-1-(cyclopropanecarbonylamino)ethenethiolate.
| Compound Name | sodium 2,2-dicyano-1-(cyclopropanecarbonylamino)ethenethiolate |
|---|---|
| PubChem CID | 135050931 |
| Molecular Formula | C8H6N3NaOS |
| Molecular Weight | 215.21 g/mol |
| Exact Mass | 215.01 |
| IUPAC Name | sodium 2,2-dicyano-1-(cyclopropanecarbonylamino)ethenethiolate |
| SMILES | N#CC(C#N)=C([S-])NC(=O)C1CC1.[Na+] |
| InChI | InChI=1S/C8H7N3OS.Na/c9-3-6(4-10)8(13)11-7(12)5-1-2-5;/h5,13H,1-2H2,(H,11,12);/q;+1/p-1 |
| InChIKey | ZOASEGQMHCZFLH-UHFFFAOYSA-M |
| XLogP | -2.68 |
| TPSA | 76.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.21 |
| LogP ≤ 5 | -2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|