C12H25NO2 — CID 167456902
ethane;N-hydroxy-4-propan-2-ylcyclohexane-1-carboxamide (PubChem CID 167456902) has the molecular formula C12H25NO2 and a molecular weight of 215.34 g/mol. Its IUPAC name is ethane;N-hydroxy-4-propan-2-ylcyclohexane-1-carboxamide.
| Compound Name | ethane;N-hydroxy-4-propan-2-ylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 167456902 |
| Molecular Formula | C12H25NO2 |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.19 |
| IUPAC Name | ethane;N-hydroxy-4-propan-2-ylcyclohexane-1-carboxamide |
| SMILES | CC.CC(C)C1CCC(C(=O)NO)CC1 |
| InChI | InChI=1S/C10H19NO2.C2H6/c1-7(2)8-3-5-9(6-4-8)10(12)11-13;1-2/h7-9,13H,3-6H2,1-2H3,(H,11,12);1-2H3 |
| InChIKey | YXESHIXOBOXVQI-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|