C14H25NO3S — CID 120526444
2-[2-[(4-propan-2-ylcyclohexanecarbonyl)amino]ethylsulfanyl]acetic acid (PubChem CID 120526444) has the molecular formula C14H25NO3S and a molecular weight of 287.43 g/mol. Its IUPAC name is 2-[2-[(4-propan-2-ylcyclohexanecarbonyl)amino]ethylsulfanyl]acetic acid.
| Compound Name | 2-[2-[(4-propan-2-ylcyclohexanecarbonyl)amino]ethylsulfanyl]acetic acid |
|---|---|
| PubChem CID | 120526444 |
| Molecular Formula | C14H25NO3S |
| Molecular Weight | 287.43 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | 2-[2-[(4-propan-2-ylcyclohexanecarbonyl)amino]ethylsulfanyl]acetic acid |
| SMILES | CC(C)C1CCC(C(=O)NCCSCC(=O)O)CC1 |
| InChI | InChI=1S/C14H25NO3S/c1-10(2)11-3-5-12(6-4-11)14(18)15-7-8-19-9-13(16)17/h10-12H,3-9H2,1-2H3,(H,15,18)(H,16,17) |
| InChIKey | RGDVNPDANCYRRV-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.43 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|