C7H6Cl2N2O — CID 155898874
N-(2,2-dichloro-1-cyanoethenyl)cyclopropanecarboxamide (PubChem CID 155898874) has the molecular formula C7H6Cl2N2O and a molecular weight of 205.04 g/mol. Its IUPAC name is N-(2,2-dichloro-1-cyanoethenyl)cyclopropanecarboxamide.
| Compound Name | N-(2,2-dichloro-1-cyanoethenyl)cyclopropanecarboxamide |
|---|---|
| PubChem CID | 155898874 |
| Molecular Formula | C7H6Cl2N2O |
| Molecular Weight | 205.04 g/mol |
| Exact Mass | 203.99 |
| IUPAC Name | N-(2,2-dichloro-1-cyanoethenyl)cyclopropanecarboxamide |
| SMILES | N#CC(NC(=O)C1CC1)=C(Cl)Cl |
| InChI | InChI=1S/C7H6Cl2N2O/c8-6(9)5(3-10)11-7(12)4-1-2-4/h4H,1-2H2,(H,11,12) |
| InChIKey | HARMCYQLEUHDER-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.04 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|