C8H3BrCl2N2O2 — CID 17012475
5-bromo-N-(2,2-dichloro-1-cyanoethenyl)furan-2-carboxamide (PubChem CID 17012475) has the molecular formula C8H3BrCl2N2O2 and a molecular weight of 309.93 g/mol. Its IUPAC name is 5-bromo-N-(2,2-dichloro-1-cyanoethenyl)furan-2-carboxamide.
| Compound Name | 5-bromo-N-(2,2-dichloro-1-cyanoethenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 17012475 |
| Molecular Formula | C8H3BrCl2N2O2 |
| Molecular Weight | 309.93 g/mol |
| Exact Mass | 307.88 |
| IUPAC Name | 5-bromo-N-(2,2-dichloro-1-cyanoethenyl)furan-2-carboxamide |
| SMILES | N#CC(NC(=O)c1ccc(Br)o1)=C(Cl)Cl |
| InChI | InChI=1S/C8H3BrCl2N2O2/c9-6-2-1-5(15-6)8(14)13-4(3-12)7(10)11/h1-2H,(H,13,14) |
| InChIKey | UGULCQUNYKLYDD-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 66.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.93 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|