About tripotassium;cyanoformate;diacetate
tripotassium;cyanoformate;diacetate (PubChem CID 173338497) has the molecular formula C6H6K3NO6
and a molecular weight of 305.41 g/mol. Its IUPAC name is tripotassium;cyanoformate;diacetate.
Molecular Properties
| Compound Name | tripotassium;cyanoformate;diacetate |
| PubChem CID | 173338497 |
| Molecular Formula | C6H6K3NO6 |
| Molecular Weight | 305.41 g/mol |
| Exact Mass | 304.91 |
| IUPAC Name | tripotassium;cyanoformate;diacetate |
| SMILES | CC(=O)[O-].CC(=O)[O-].N#CC(=O)[O-].[K+].[K+].[K+] |
| InChI | InChI=1S/C2HNO2.2C2H4O2.3K/c3-1-2(4)5;2*1-2(3)4;;;/h(H,4,5);2*1H3,(H,3,4);;;/q;;;3*+1/p-3 |
| InChIKey | OGDUNFPWVLQZKG-UHFFFAOYSA-K |
| XLogP | -13.22 |
| TPSA | 144.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.41 |
| LogP ≤ 5 | -13.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_cyanide', 'substructure': 'N/A'} |
|---|
Analyze tripotassium;cyanoformate;diacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tripotassium;cyanoformate;diacetate?
The IUPAC name of tripotassium;cyanoformate;diacetate (CID 173338497) is tripotassium;cyanoformate;diacetate.
What is the SMILES notation for tripotassium;cyanoformate;diacetate?
The canonical SMILES for tripotassium;cyanoformate;diacetate is CC(=O)[O-].CC(=O)[O-].N#CC(=O)[O-].[K+].[K+].[K+].
What is the InChIKey of tripotassium;cyanoformate;diacetate?
The InChIKey is OGDUNFPWVLQZKG-UHFFFAOYSA-K. The full InChI is InChI=1S/C2HNO2.2C2H4O2.3K/c3-1-2(4)5;2*1-2(3)4;;;/h(H,4,5);2*1H3,(H,3,4);;;/q;;;3*+1/p-3.
What are the key properties of tripotassium;cyanoformate;diacetate?
tripotassium;cyanoformate;diacetate has a molecular weight of 305.41 g/mol, XLogP of -13.22, 0 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for tripotassium;cyanoformate;diacetate is sourced from PubChem (CID 173338497), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).