C22H10N4 — CID 15821675
ethene-1,1,2,2-tetracarbonitrile;pyrene (PubChem CID 15821675) has the molecular formula C22H10N4 and a molecular weight of 330.35 g/mol. Its IUPAC name is ethene-1,1,2,2-tetracarbonitrile;pyrene.
| Compound Name | ethene-1,1,2,2-tetracarbonitrile;pyrene |
|---|---|
| PubChem CID | 15821675 |
| Molecular Formula | C22H10N4 |
| Molecular Weight | 330.35 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | ethene-1,1,2,2-tetracarbonitrile;pyrene |
| SMILES | N#CC(C#N)=C(C#N)C#N.c1cc2ccc3cccc4ccc(c1)c2c34 |
| InChI | InChI=1S/C16H10.C6N4/c1-3-11-7-9-13-5-2-6-14-10-8-12(4-1)15(11)16(13)14;7-1-5(2-8)6(3-9)4-10/h1-10H; |
| InChIKey | ULSRMTQRNBNPAH-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 95.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.35 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|