C13H9N3 — CID 89036790
(Z)-2-phenylbut-2-ene-1,1,3-tricarbonitrile (PubChem CID 89036790) has the molecular formula C13H9N3 and a molecular weight of 207.24 g/mol. Its IUPAC name is (Z)-2-phenylbut-2-ene-1,1,3-tricarbonitrile.
| Compound Name | (Z)-2-phenylbut-2-ene-1,1,3-tricarbonitrile |
|---|---|
| PubChem CID | 89036790 |
| Molecular Formula | C13H9N3 |
| Molecular Weight | 207.24 g/mol |
| Exact Mass | 207.08 |
| IUPAC Name | (Z)-2-phenylbut-2-ene-1,1,3-tricarbonitrile |
| SMILES | C/C(C#N)=C(/c1ccccc1)C(C#N)C#N |
| InChI | InChI=1S/C13H9N3/c1-10(7-14)13(12(8-15)9-16)11-5-3-2-4-6-11/h2-6,12H,1H3/b13-10+ |
| InChIKey | BDIKYKRBOLZHMN-JLHYYAGUSA-N |
| XLogP | 2.65 |
| TPSA | 71.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.24 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|