About sodium;benzonitrile;ethane
sodium;benzonitrile;ethane (PubChem CID 174741528) has the molecular formula C9H10NNa
and a molecular weight of 155.18 g/mol. Its IUPAC name is sodium;benzonitrile;ethane.
Molecular Properties
| Compound Name | sodium;benzonitrile;ethane |
| PubChem CID | 174741528 |
| Molecular Formula | C9H10NNa |
| Molecular Weight | 155.18 g/mol |
| Exact Mass | 155.07 |
| IUPAC Name | sodium;benzonitrile;ethane |
| SMILES | N#Cc1ccccc1.[CH2-]C.[Na+] |
| InChI | InChI=1S/C7H5N.C2H5.Na/c8-6-7-4-2-1-3-5-7;1-2;/h1-5H;1H2,2H3;/q;-1;+1 |
| InChIKey | LTKZBAJHIXUVRE-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.18 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze sodium;benzonitrile;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;benzonitrile;ethane?
The IUPAC name of sodium;benzonitrile;ethane (CID 174741528) is sodium;benzonitrile;ethane.
What is the SMILES notation for sodium;benzonitrile;ethane?
The canonical SMILES for sodium;benzonitrile;ethane is N#Cc1ccccc1.[CH2-]C.[Na+].
What is the InChIKey of sodium;benzonitrile;ethane?
The InChIKey is LTKZBAJHIXUVRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5N.C2H5.Na/c8-6-7-4-2-1-3-5-7;1-2;/h1-5H;1H2,2H3;/q;-1;+1.
What are the key properties of sodium;benzonitrile;ethane?
sodium;benzonitrile;ethane has a molecular weight of 155.18 g/mol, XLogP of -0.60, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;benzonitrile;ethane is sourced from PubChem (CID 174741528), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).