About sodium;benzonitrile;azide
sodium;benzonitrile;azide (PubChem CID 158967715) has the molecular formula C7H5N4Na
and a molecular weight of 168.13 g/mol. Its IUPAC name is sodium;benzonitrile;azide.
Molecular Properties
| Compound Name | sodium;benzonitrile;azide |
| PubChem CID | 158967715 |
| Molecular Formula | C7H5N4Na |
| Molecular Weight | 168.13 g/mol |
| Exact Mass | 168.04 |
| IUPAC Name | sodium;benzonitrile;azide |
| SMILES | N#Cc1ccccc1.[N-]=[N+]=[N-].[Na+] |
| InChI | InChI=1S/C7H5N.N3.Na/c8-6-7-4-2-1-3-5-7;1-3-2;/h1-5H;;/q;-1;+1 |
| InChIKey | JNKLNXWXUZYDLV-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 82.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.13 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze sodium;benzonitrile;azide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;benzonitrile;azide?
The IUPAC name of sodium;benzonitrile;azide (CID 158967715) is sodium;benzonitrile;azide.
What is the SMILES notation for sodium;benzonitrile;azide?
The canonical SMILES for sodium;benzonitrile;azide is N#Cc1ccccc1.[N-]=[N+]=[N-].[Na+].
What is the InChIKey of sodium;benzonitrile;azide?
The InChIKey is JNKLNXWXUZYDLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5N.N3.Na/c8-6-7-4-2-1-3-5-7;1-3-2;/h1-5H;;/q;-1;+1.
What are the key properties of sodium;benzonitrile;azide?
sodium;benzonitrile;azide has a molecular weight of 168.13 g/mol, XLogP of -0.57, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;benzonitrile;azide is sourced from PubChem (CID 158967715), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).