About Sodium;benzonitrile;hydroxide
Sodium;benzonitrile;hydroxide (PubChem CID 174884418) has the molecular formula C7H6NNaO
and a molecular weight of 143.12 g/mol. Its IUPAC name is sodium;benzonitrile;hydroxide.
Molecular Properties
| Compound Name | Sodium;benzonitrile;hydroxide |
| PubChem CID | 174884418 |
| Molecular Formula | C7H6NNaO |
| Molecular Weight | 143.12 g/mol |
| Exact Mass | 143.03 |
| IUPAC Name | sodium;benzonitrile;hydroxide |
| SMILES | C1=CC=C(C=C1)C#N.[OH-].[Na+] |
| InChI | InChI=1S/C7H5N.Na.H2O/c8-6-7-4-2-1-3-5-7;;/h1-5H;;1H2/q;+1;/p-1 |
| InChIKey | YHKSQKXKGSCEMS-UHFFFAOYSA-M |
| XLogP | — |
| TPSA | 24.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | 105 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze Sodium;benzonitrile;hydroxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Sodium;benzonitrile;hydroxide?
The IUPAC name of Sodium;benzonitrile;hydroxide (CID 174884418) is sodium;benzonitrile;hydroxide.
What is the SMILES notation for Sodium;benzonitrile;hydroxide?
The canonical SMILES for Sodium;benzonitrile;hydroxide is C1=CC=C(C=C1)C#N.[OH-].[Na+].
What is the InChIKey of Sodium;benzonitrile;hydroxide?
The InChIKey is YHKSQKXKGSCEMS-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H5N.Na.H2O/c8-6-7-4-2-1-3-5-7;;/h1-5H;;1H2/q;+1;/p-1.
What are the key properties of Sodium;benzonitrile;hydroxide?
Sodium;benzonitrile;hydroxide has a molecular weight of 143.12 g/mol, XLogP of not available, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for Sodium;benzonitrile;hydroxide is sourced from PubChem (CID 174884418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).