About bis(benzonitrile);dibromonickel
bis(benzonitrile);dibromonickel (PubChem CID 22599309) has the molecular formula C14H10Br2N2Ni
and a molecular weight of 424.75 g/mol. Its IUPAC name is bis(benzonitrile);dibromonickel.
Molecular Properties
| Compound Name | bis(benzonitrile);dibromonickel |
| PubChem CID | 22599309 |
| Molecular Formula | C14H10Br2N2Ni |
| Molecular Weight | 424.75 g/mol |
| Exact Mass | 421.86 |
| IUPAC Name | bis(benzonitrile);dibromonickel |
| SMILES | Br[Ni]Br.N#Cc1ccccc1.N#Cc1ccccc1 |
| InChI | InChI=1S/2C7H5N.2BrH.Ni/c2*8-6-7-4-2-1-3-5-7;;;/h2*1-5H;2*1H;/q;;;;+2/p-2 |
| InChIKey | PUINFQOEFDQNEB-UHFFFAOYSA-L |
| XLogP | 4.81 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 424.75 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze bis(benzonitrile);dibromonickel with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(benzonitrile);dibromonickel?
The IUPAC name of bis(benzonitrile);dibromonickel (CID 22599309) is bis(benzonitrile);dibromonickel.
What is the SMILES notation for bis(benzonitrile);dibromonickel?
The canonical SMILES for bis(benzonitrile);dibromonickel is Br[Ni]Br.N#Cc1ccccc1.N#Cc1ccccc1.
What is the InChIKey of bis(benzonitrile);dibromonickel?
The InChIKey is PUINFQOEFDQNEB-UHFFFAOYSA-L. The full InChI is InChI=1S/2C7H5N.2BrH.Ni/c2*8-6-7-4-2-1-3-5-7;;;/h2*1-5H;2*1H;/q;;;;+2/p-2.
What are the key properties of bis(benzonitrile);dibromonickel?
bis(benzonitrile);dibromonickel has a molecular weight of 424.75 g/mol, XLogP of 4.81, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bis(benzonitrile);dibromonickel is sourced from PubChem (CID 22599309), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).