C11H12N2O — CID 54762673
4-acetyl-2,6-dimethylideneheptanedinitrile (PubChem CID 54762673) has the molecular formula C11H12N2O and a molecular weight of 188.23 g/mol. Its IUPAC name is 4-acetyl-2,6-dimethylideneheptanedinitrile.
| Compound Name | 4-acetyl-2,6-dimethylideneheptanedinitrile |
|---|---|
| PubChem CID | 54762673 |
| Molecular Formula | C11H12N2O |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.09 |
| IUPAC Name | 4-acetyl-2,6-dimethylideneheptanedinitrile |
| SMILES | C=C(C#N)CC(CC(=C)C#N)C(C)=O |
| InChI | InChI=1S/C11H12N2O/c1-8(6-12)4-11(10(3)14)5-9(2)7-13/h11H,1-2,4-5H2,3H3 |
| InChIKey | NBYNFRCIGRYGJH-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 64.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|