About 3-acetylpentanedioic acid
3-acetylpentanedioic acid (PubChem CID 19838981) has the molecular formula C7H10O5
and a molecular weight of 174.15 g/mol. Its IUPAC name is 3-acetylpentanedioic acid.
Molecular Properties
| Compound Name | 3-acetylpentanedioic acid |
| PubChem CID | 19838981 |
| Molecular Formula | C7H10O5 |
| Molecular Weight | 174.15 g/mol |
| Exact Mass | 174.05 |
| IUPAC Name | 3-acetylpentanedioic acid |
| SMILES | CC(=O)C(CC(=O)O)CC(=O)O |
| InChI | InChI=1S/C7H10O5/c1-4(8)5(2-6(9)10)3-7(11)12/h5H,2-3H2,1H3,(H,9,10)(H,11,12) |
| InChIKey | TZPGYCKKEMNHRS-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.15 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-acetylpentanedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-acetylpentanedioic acid?
The IUPAC name of 3-acetylpentanedioic acid (CID 19838981) is 3-acetylpentanedioic acid.
What is the SMILES notation for 3-acetylpentanedioic acid?
The canonical SMILES for 3-acetylpentanedioic acid is CC(=O)C(CC(=O)O)CC(=O)O.
What is the InChIKey of 3-acetylpentanedioic acid?
The InChIKey is TZPGYCKKEMNHRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10O5/c1-4(8)5(2-6(9)10)3-7(11)12/h5H,2-3H2,1H3,(H,9,10)(H,11,12).
What are the key properties of 3-acetylpentanedioic acid?
3-acetylpentanedioic acid has a molecular weight of 174.15 g/mol, XLogP of 0.14, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-acetylpentanedioic acid is sourced from PubChem (CID 19838981), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).