C7H6N2O2 — CID 14709476
2,4-dicyanopent-4-enoic acid (PubChem CID 14709476) has the molecular formula C7H6N2O2 and a molecular weight of 150.14 g/mol. Its IUPAC name is 2,4-dicyanopent-4-enoic acid.
| Compound Name | 2,4-dicyanopent-4-enoic acid |
|---|---|
| PubChem CID | 14709476 |
| Molecular Formula | C7H6N2O2 |
| Molecular Weight | 150.14 g/mol |
| Exact Mass | 150.04 |
| IUPAC Name | 2,4-dicyanopent-4-enoic acid |
| SMILES | C=C(C#N)CC(C#N)C(=O)O |
| InChI | InChI=1S/C7H6N2O2/c1-5(3-8)2-6(4-9)7(10)11/h6H,1-2H2,(H,10,11) |
| InChIKey | WAAWOOINFKDWRI-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 84.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.14 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|