2-cyanononadecanoic acid

C20H37NO2 — CID 87316687

IUPAC2-cyanononadecanoic acid
SMILESCCCCCCCCCCCCCCCCCC(C#N)C(=O)O
InChIInChI=1S/C20H37NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-19(18-21)20(22)23/h19H,2-17H2,1H3,(H,22,23)
InChIKeyVWOOHJYZIIGKDE-UHFFFAOYSA-N
MW323.52 g/mol
LogP6.47
Rot. Bonds17

About 2-cyanononadecanoic acid

2-cyanononadecanoic acid (PubChem CID 87316687) has the molecular formula C20H37NO2 and a molecular weight of 323.52 g/mol. Its IUPAC name is 2-cyanononadecanoic acid.

Molecular Properties

Compound Name2-cyanononadecanoic acid
PubChem CID87316687
Molecular FormulaC20H37NO2
Molecular Weight323.52 g/mol
Exact Mass323.28
IUPAC Name2-cyanononadecanoic acid
SMILESCCCCCCCCCCCCCCCCCC(C#N)C(=O)O
InChIInChI=1S/C20H37NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-19(18-21)20(22)23/h19H,2-17H2,1H3,(H,22,23)
InChIKeyVWOOHJYZIIGKDE-UHFFFAOYSA-N
XLogP6.47
TPSA61.09 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds17
Heavy Atoms23
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500323.52
LogP ≤ 56.47
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 2-cyanononadecanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-cyanononadecanoic acid?
The IUPAC name of 2-cyanononadecanoic acid (CID 87316687) is 2-cyanononadecanoic acid.
What is the SMILES notation for 2-cyanononadecanoic acid?
The canonical SMILES for 2-cyanononadecanoic acid is CCCCCCCCCCCCCCCCCC(C#N)C(=O)O.
What is the InChIKey of 2-cyanononadecanoic acid?
The InChIKey is VWOOHJYZIIGKDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H37NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-19(18-21)20(22)23/h19H,2-17H2,1H3,(H,22,23).
What are the key properties of 2-cyanononadecanoic acid?
2-cyanononadecanoic acid has a molecular weight of 323.52 g/mol, XLogP of 6.47, 17 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyanononadecanoic acid is sourced from PubChem (CID 87316687), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).