About 2-cyanononadecanoic acid
2-cyanononadecanoic acid (PubChem CID 87316687) has the molecular formula C20H37NO2
and a molecular weight of 323.52 g/mol. Its IUPAC name is 2-cyanononadecanoic acid.
Molecular Properties
| Compound Name | 2-cyanononadecanoic acid |
| PubChem CID | 87316687 |
| Molecular Formula | C20H37NO2 |
| Molecular Weight | 323.52 g/mol |
| Exact Mass | 323.28 |
| IUPAC Name | 2-cyanononadecanoic acid |
| SMILES | CCCCCCCCCCCCCCCCCC(C#N)C(=O)O |
| InChI | InChI=1S/C20H37NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-19(18-21)20(22)23/h19H,2-17H2,1H3,(H,22,23) |
| InChIKey | VWOOHJYZIIGKDE-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 323.52 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-cyanononadecanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyanononadecanoic acid?
The IUPAC name of 2-cyanononadecanoic acid (CID 87316687) is 2-cyanononadecanoic acid.
What is the SMILES notation for 2-cyanononadecanoic acid?
The canonical SMILES for 2-cyanononadecanoic acid is CCCCCCCCCCCCCCCCCC(C#N)C(=O)O.
What is the InChIKey of 2-cyanononadecanoic acid?
The InChIKey is VWOOHJYZIIGKDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H37NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-19(18-21)20(22)23/h19H,2-17H2,1H3,(H,22,23).
What are the key properties of 2-cyanononadecanoic acid?
2-cyanononadecanoic acid has a molecular weight of 323.52 g/mol, XLogP of 6.47, 17 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyanononadecanoic acid is sourced from PubChem (CID 87316687), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).