About 2-cyanatooctanoic acid
2-cyanatooctanoic acid (PubChem CID 146513999) has the molecular formula C9H15NO3
and a molecular weight of 185.22 g/mol. Its IUPAC name is 2-cyanatooctanoic acid.
Molecular Properties
| Compound Name | 2-cyanatooctanoic acid |
| PubChem CID | 146513999 |
| Molecular Formula | C9H15NO3 |
| Molecular Weight | 185.22 g/mol |
| Exact Mass | 185.11 |
| IUPAC Name | 2-cyanatooctanoic acid |
| SMILES | CCCCCCC(OC#N)C(=O)O |
| InChI | InChI=1S/C9H15NO3/c1-2-3-4-5-6-8(9(11)12)13-7-10/h8H,2-6H2,1H3,(H,11,12) |
| InChIKey | YJEIGPMHXDFJGT-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 70.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.22 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|
Analyze 2-cyanatooctanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyanatooctanoic acid?
The IUPAC name of 2-cyanatooctanoic acid (CID 146513999) is 2-cyanatooctanoic acid.
What is the SMILES notation for 2-cyanatooctanoic acid?
The canonical SMILES for 2-cyanatooctanoic acid is CCCCCCC(OC#N)C(=O)O.
What is the InChIKey of 2-cyanatooctanoic acid?
The InChIKey is YJEIGPMHXDFJGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NO3/c1-2-3-4-5-6-8(9(11)12)13-7-10/h8H,2-6H2,1H3,(H,11,12).
What are the key properties of 2-cyanatooctanoic acid?
2-cyanatooctanoic acid has a molecular weight of 185.22 g/mol, XLogP of 1.91, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyanatooctanoic acid is sourced from PubChem (CID 146513999), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).