About 2-methoxyhexadecanoic acid
2-methoxyhexadecanoic acid (PubChem CID 656825) has the molecular formula C17H34O3
and a molecular weight of 286.46 g/mol. Its IUPAC name is 2-methoxyhexadecanoic acid.
Molecular Properties
| Compound Name | 2-methoxyhexadecanoic acid |
| PubChem CID | 656825 |
| Molecular Formula | C17H34O3 |
| Molecular Weight | 286.46 g/mol |
| Exact Mass | 286.25 |
| IUPAC Name | 2-methoxyhexadecanoic acid |
| SMILES | CCCCCCCCCCCCCCC(OC)C(=O)O |
| InChI | InChI=1S/C17H34O3/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16(20-2)17(18)19/h16H,3-15H2,1-2H3,(H,18,19) |
| InChIKey | YNBIUHDYZWCBSF-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 286.46 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-methoxyhexadecanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxyhexadecanoic acid?
The IUPAC name of 2-methoxyhexadecanoic acid (CID 656825) is 2-methoxyhexadecanoic acid.
What is the SMILES notation for 2-methoxyhexadecanoic acid?
The canonical SMILES for 2-methoxyhexadecanoic acid is CCCCCCCCCCCCCCC(OC)C(=O)O.
What is the InChIKey of 2-methoxyhexadecanoic acid?
The InChIKey is YNBIUHDYZWCBSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H34O3/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16(20-2)17(18)19/h16H,3-15H2,1-2H3,(H,18,19).
What are the key properties of 2-methoxyhexadecanoic acid?
2-methoxyhexadecanoic acid has a molecular weight of 286.46 g/mol, XLogP of 5.18, 15 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxyhexadecanoic acid is sourced from PubChem (CID 656825), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).