About 2-bromooxyheptanoic acid
2-bromooxyheptanoic acid (PubChem CID 151321599) has the molecular formula C7H13BrO3
and a molecular weight of 225.08 g/mol. Its IUPAC name is 2-bromooxyheptanoic acid.
Molecular Properties
| Compound Name | 2-bromooxyheptanoic acid |
| PubChem CID | 151321599 |
| Molecular Formula | C7H13BrO3 |
| Molecular Weight | 225.08 g/mol |
| Exact Mass | 224.00 |
| IUPAC Name | 2-bromooxyheptanoic acid |
| SMILES | CCCCCC(OBr)C(=O)O |
| InChI | InChI=1S/C7H13BrO3/c1-2-3-4-5-6(11-8)7(9)10/h6H,2-5H2,1H3,(H,9,10) |
| InChIKey | OGORRIZYAYQQEC-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.08 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-bromooxyheptanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromooxyheptanoic acid?
The IUPAC name of 2-bromooxyheptanoic acid (CID 151321599) is 2-bromooxyheptanoic acid.
What is the SMILES notation for 2-bromooxyheptanoic acid?
The canonical SMILES for 2-bromooxyheptanoic acid is CCCCCC(OBr)C(=O)O.
What is the InChIKey of 2-bromooxyheptanoic acid?
The InChIKey is OGORRIZYAYQQEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13BrO3/c1-2-3-4-5-6(11-8)7(9)10/h6H,2-5H2,1H3,(H,9,10).
What are the key properties of 2-bromooxyheptanoic acid?
2-bromooxyheptanoic acid has a molecular weight of 225.08 g/mol, XLogP of 2.35, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromooxyheptanoic acid is sourced from PubChem (CID 151321599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).