2-bromooxyheptanoic acid

C7H13BrO3 — CID 151321599

IUPAC2-bromooxyheptanoic acid
SMILESCCCCCC(OBr)C(=O)O
InChIInChI=1S/C7H13BrO3/c1-2-3-4-5-6(11-8)7(9)10/h6H,2-5H2,1H3,(H,9,10)
InChIKeyOGORRIZYAYQQEC-UHFFFAOYSA-N
MW225.08 g/mol
LogP2.35
Rot. Bonds6

About 2-bromooxyheptanoic acid

2-bromooxyheptanoic acid (PubChem CID 151321599) has the molecular formula C7H13BrO3 and a molecular weight of 225.08 g/mol. Its IUPAC name is 2-bromooxyheptanoic acid.

Molecular Properties

Compound Name2-bromooxyheptanoic acid
PubChem CID151321599
Molecular FormulaC7H13BrO3
Molecular Weight225.08 g/mol
Exact Mass224.00
IUPAC Name2-bromooxyheptanoic acid
SMILESCCCCCC(OBr)C(=O)O
InChIInChI=1S/C7H13BrO3/c1-2-3-4-5-6(11-8)7(9)10/h6H,2-5H2,1H3,(H,9,10)
InChIKeyOGORRIZYAYQQEC-UHFFFAOYSA-N
XLogP2.35
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds6
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500225.08
LogP ≤ 52.35
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 2-bromooxyheptanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-bromooxyheptanoic acid?
The IUPAC name of 2-bromooxyheptanoic acid (CID 151321599) is 2-bromooxyheptanoic acid.
What is the SMILES notation for 2-bromooxyheptanoic acid?
The canonical SMILES for 2-bromooxyheptanoic acid is CCCCCC(OBr)C(=O)O.
What is the InChIKey of 2-bromooxyheptanoic acid?
The InChIKey is OGORRIZYAYQQEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13BrO3/c1-2-3-4-5-6(11-8)7(9)10/h6H,2-5H2,1H3,(H,9,10).
What are the key properties of 2-bromooxyheptanoic acid?
2-bromooxyheptanoic acid has a molecular weight of 225.08 g/mol, XLogP of 2.35, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromooxyheptanoic acid is sourced from PubChem (CID 151321599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).