About azane;2-cyanoundecanoic acid
azane;2-cyanoundecanoic acid (PubChem CID 174447184) has the molecular formula C12H24N2O2
and a molecular weight of 228.34 g/mol. Its IUPAC name is azane;2-cyanoundecanoic acid.
Molecular Properties
| Compound Name | azane;2-cyanoundecanoic acid |
| PubChem CID | 174447184 |
| Molecular Formula | C12H24N2O2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.18 |
| IUPAC Name | azane;2-cyanoundecanoic acid |
| SMILES | CCCCCCCCCC(C#N)C(=O)O.N |
| InChI | InChI=1S/C12H21NO2.H3N/c1-2-3-4-5-6-7-8-9-11(10-13)12(14)15;/h11H,2-9H2,1H3,(H,14,15);1H3 |
| InChIKey | JYAYIEDNIYIGBW-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 96.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze azane;2-cyanoundecanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;2-cyanoundecanoic acid?
The IUPAC name of azane;2-cyanoundecanoic acid (CID 174447184) is azane;2-cyanoundecanoic acid.
What is the SMILES notation for azane;2-cyanoundecanoic acid?
The canonical SMILES for azane;2-cyanoundecanoic acid is CCCCCCCCCC(C#N)C(=O)O.N.
What is the InChIKey of azane;2-cyanoundecanoic acid?
The InChIKey is JYAYIEDNIYIGBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21NO2.H3N/c1-2-3-4-5-6-7-8-9-11(10-13)12(14)15;/h11H,2-9H2,1H3,(H,14,15);1H3.
What are the key properties of azane;2-cyanoundecanoic acid?
azane;2-cyanoundecanoic acid has a molecular weight of 228.34 g/mol, XLogP of 3.51, 9 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azane;2-cyanoundecanoic acid is sourced from PubChem (CID 174447184), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).