About 2-cyanoheptadecanoic acid
2-cyanoheptadecanoic acid (PubChem CID 87316675) has the molecular formula C18H33NO2
and a molecular weight of 295.47 g/mol. Its IUPAC name is 2-cyanoheptadecanoic acid.
Molecular Properties
| Compound Name | 2-cyanoheptadecanoic acid |
| PubChem CID | 87316675 |
| Molecular Formula | C18H33NO2 |
| Molecular Weight | 295.47 g/mol |
| Exact Mass | 295.25 |
| IUPAC Name | 2-cyanoheptadecanoic acid |
| SMILES | CCCCCCCCCCCCCCCC(C#N)C(=O)O |
| InChI | InChI=1S/C18H33NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-17(16-19)18(20)21/h17H,2-15H2,1H3,(H,20,21) |
| InChIKey | DLISVKLXABFUHT-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 295.47 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-cyanoheptadecanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyanoheptadecanoic acid?
The IUPAC name of 2-cyanoheptadecanoic acid (CID 87316675) is 2-cyanoheptadecanoic acid.
What is the SMILES notation for 2-cyanoheptadecanoic acid?
The canonical SMILES for 2-cyanoheptadecanoic acid is CCCCCCCCCCCCCCCC(C#N)C(=O)O.
What is the InChIKey of 2-cyanoheptadecanoic acid?
The InChIKey is DLISVKLXABFUHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H33NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-17(16-19)18(20)21/h17H,2-15H2,1H3,(H,20,21).
What are the key properties of 2-cyanoheptadecanoic acid?
2-cyanoheptadecanoic acid has a molecular weight of 295.47 g/mol, XLogP of 5.69, 15 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyanoheptadecanoic acid is sourced from PubChem (CID 87316675), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).