About 3,3-dicyanopropanoic acid
3,3-dicyanopropanoic acid (PubChem CID 22288491) has the molecular formula C5H4N2O2
and a molecular weight of 124.10 g/mol. Its IUPAC name is 3,3-dicyanopropanoic acid.
Molecular Properties
| Compound Name | 3,3-dicyanopropanoic acid |
| PubChem CID | 22288491 |
| Molecular Formula | C5H4N2O2 |
| Molecular Weight | 124.10 g/mol |
| Exact Mass | 124.03 |
| IUPAC Name | 3,3-dicyanopropanoic acid |
| SMILES | N#CC(C#N)CC(=O)O |
| InChI | InChI=1S/C5H4N2O2/c6-2-4(3-7)1-5(8)9/h4H,1H2,(H,8,9) |
| InChIKey | FTMIYDLTXCXQPP-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 84.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.10 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3,3-dicyanopropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-dicyanopropanoic acid?
The IUPAC name of 3,3-dicyanopropanoic acid (CID 22288491) is 3,3-dicyanopropanoic acid.
What is the SMILES notation for 3,3-dicyanopropanoic acid?
The canonical SMILES for 3,3-dicyanopropanoic acid is N#CC(C#N)CC(=O)O.
What is the InChIKey of 3,3-dicyanopropanoic acid?
The InChIKey is FTMIYDLTXCXQPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4N2O2/c6-2-4(3-7)1-5(8)9/h4H,1H2,(H,8,9).
What are the key properties of 3,3-dicyanopropanoic acid?
3,3-dicyanopropanoic acid has a molecular weight of 124.10 g/mol, XLogP of 0.12, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-dicyanopropanoic acid is sourced from PubChem (CID 22288491), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).