C6H8N2O4 — CID 162885810
(2R,3S)-2-amino-3-cyanopentanedioic acid (PubChem CID 162885810) has the molecular formula C6H8N2O4 and a molecular weight of 172.14 g/mol. Its IUPAC name is (2R,3S)-2-amino-3-cyanopentanedioic acid.
| Compound Name | (2R,3S)-2-amino-3-cyanopentanedioic acid |
|---|---|
| PubChem CID | 162885810 |
| Molecular Formula | C6H8N2O4 |
| Molecular Weight | 172.14 g/mol |
| Exact Mass | 172.05 |
| IUPAC Name | (2R,3S)-2-amino-3-cyanopentanedioic acid |
| SMILES | N#C[C@@H](CC(=O)O)[C@@H](N)C(=O)O |
| InChI | InChI=1S/C6H8N2O4/c7-2-3(1-4(9)10)5(8)6(11)12/h3,5H,1,8H2,(H,9,10)(H,11,12)/t3-,5-/m1/s1 |
| InChIKey | ILQROMFBFXKCAZ-NQXXGFSBSA-N |
| XLogP | -0.99 |
| TPSA | 124.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.14 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |