(1S)-1-aminopropane-1,2,3-tricarboxylic acid

C6H9NO6 — CID 20605454

IUPAC(1S)-1-aminopropane-1,2,3-tricarboxylic acid
SMILESN[C@H](C(=O)O)C(CC(=O)O)C(=O)O
InChIInChI=1S/C6H9NO6/c7-4(6(12)13)2(5(10)11)1-3(8)9/h2,4H,1,7H2,(H,8,9)(H,10,11)(H,12,13)/t2?,4-/m0/s1
InChIKeyBZJZJZZWFXEMRG-AOIFVJIMSA-N
MW191.14 g/mol
LogP-1.43
Rot. Bonds5

About (1S)-1-aminopropane-1,2,3-tricarboxylic acid

(1S)-1-aminopropane-1,2,3-tricarboxylic acid (PubChem CID 20605454) has the molecular formula C6H9NO6 and a molecular weight of 191.14 g/mol. Its IUPAC name is (1S)-1-aminopropane-1,2,3-tricarboxylic acid.

Molecular Properties

Compound Name(1S)-1-aminopropane-1,2,3-tricarboxylic acid
PubChem CID20605454
Molecular FormulaC6H9NO6
Molecular Weight191.14 g/mol
Exact Mass191.04
IUPAC Name(1S)-1-aminopropane-1,2,3-tricarboxylic acid
SMILESN[C@H](C(=O)O)C(CC(=O)O)C(=O)O
InChIInChI=1S/C6H9NO6/c7-4(6(12)13)2(5(10)11)1-3(8)9/h2,4H,1,7H2,(H,8,9)(H,10,11)(H,12,13)/t2?,4-/m0/s1
InChIKeyBZJZJZZWFXEMRG-AOIFVJIMSA-N
XLogP-1.43
TPSA137.92 Ų
H-Bond Donors4
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500191.14
LogP ≤ 5-1.43
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 104

Analyze (1S)-1-aminopropane-1,2,3-tricarboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (1S)-1-aminopropane-1,2,3-tricarboxylic acid?
The IUPAC name of (1S)-1-aminopropane-1,2,3-tricarboxylic acid (CID 20605454) is (1S)-1-aminopropane-1,2,3-tricarboxylic acid.
What is the SMILES notation for (1S)-1-aminopropane-1,2,3-tricarboxylic acid?
The canonical SMILES for (1S)-1-aminopropane-1,2,3-tricarboxylic acid is N[C@H](C(=O)O)C(CC(=O)O)C(=O)O.
What is the InChIKey of (1S)-1-aminopropane-1,2,3-tricarboxylic acid?
The InChIKey is BZJZJZZWFXEMRG-AOIFVJIMSA-N. The full InChI is InChI=1S/C6H9NO6/c7-4(6(12)13)2(5(10)11)1-3(8)9/h2,4H,1,7H2,(H,8,9)(H,10,11)(H,12,13)/t2?,4-/m0/s1.
What are the key properties of (1S)-1-aminopropane-1,2,3-tricarboxylic acid?
(1S)-1-aminopropane-1,2,3-tricarboxylic acid has a molecular weight of 191.14 g/mol, XLogP of -1.43, 5 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-1-aminopropane-1,2,3-tricarboxylic acid is sourced from PubChem (CID 20605454), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).