C6H10O8 — CID 141140377
1-hydroxypropane-1,2,3-tricarboxylic acid;hydrate (PubChem CID 141140377) has the molecular formula C6H10O8 and a molecular weight of 210.14 g/mol. Its IUPAC name is 1-hydroxypropane-1,2,3-tricarboxylic acid;hydrate.
| Compound Name | 1-hydroxypropane-1,2,3-tricarboxylic acid;hydrate |
|---|---|
| PubChem CID | 141140377 |
| Molecular Formula | C6H10O8 |
| Molecular Weight | 210.14 g/mol |
| Exact Mass | 210.04 |
| IUPAC Name | 1-hydroxypropane-1,2,3-tricarboxylic acid;hydrate |
| SMILES | O.O=C(O)CC(C(=O)O)C(O)C(=O)O |
| InChI | InChI=1S/C6H8O7.H2O/c7-3(8)1-2(5(10)11)4(9)6(12)13;/h2,4,9H,1H2,(H,7,8)(H,10,11)(H,12,13);1H2 |
| InChIKey | JCEBOEJFYIHZEA-UHFFFAOYSA-N |
| XLogP | -2.22 |
| TPSA | 163.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.14 |
| LogP ≤ 5 | -2.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |