C8H11NO8 — CID 24800405
2-[2-(carboxymethylamino)-1-hydroxy-2-oxoethyl]butanedioic acid (PubChem CID 24800405) has the molecular formula C8H11NO8 and a molecular weight of 249.17 g/mol. Its IUPAC name is 2-[2-(carboxymethylamino)-1-hydroxy-2-oxoethyl]butanedioic acid.
| Compound Name | 2-[2-(carboxymethylamino)-1-hydroxy-2-oxoethyl]butanedioic acid |
|---|---|
| PubChem CID | 24800405 |
| Molecular Formula | C8H11NO8 |
| Molecular Weight | 249.17 g/mol |
| Exact Mass | 249.05 |
| IUPAC Name | 2-[2-(carboxymethylamino)-1-hydroxy-2-oxoethyl]butanedioic acid |
| SMILES | O=C(O)CNC(=O)C(O)C(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C8H11NO8/c10-4(11)1-3(8(16)17)6(14)7(15)9-2-5(12)13/h3,6,14H,1-2H2,(H,9,15)(H,10,11)(H,12,13)(H,16,17) |
| InChIKey | IKTXUZHVZMDQFK-UHFFFAOYSA-N |
| XLogP | -2.28 |
| TPSA | 161.23 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.17 |
| LogP ≤ 5 | -2.28 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |