C6H7KO7 — CID 122361543
potassium (2R,3R)-2-(carboxymethyl)-3,4-dihydroxy-4-oxobutanoate (PubChem CID 122361543) has the molecular formula C6H7KO7 and a molecular weight of 230.21 g/mol. Its IUPAC name is potassium (2R,3R)-2-(carboxymethyl)-3,4-dihydroxy-4-oxobutanoate.
| Compound Name | potassium (2R,3R)-2-(carboxymethyl)-3,4-dihydroxy-4-oxobutanoate |
|---|---|
| PubChem CID | 122361543 |
| Molecular Formula | C6H7KO7 |
| Molecular Weight | 230.21 g/mol |
| Exact Mass | 229.98 |
| IUPAC Name | potassium (2R,3R)-2-(carboxymethyl)-3,4-dihydroxy-4-oxobutanoate |
| SMILES | O=C(O)CC(C(=O)[O-])[C@@H](O)C(=O)O.[K+] |
| InChI | InChI=1S/C6H8O7.K/c7-3(8)1-2(5(10)11)4(9)6(12)13;/h2,4,9H,1H2,(H,7,8)(H,10,11)(H,12,13);/q;+1/p-1/t2?,4-;/m1./s1 |
| InChIKey | IVLPTBJBFVJENN-ADDMCRJJSA-M |
| XLogP | -5.72 |
| TPSA | 134.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.21 |
| LogP ≤ 5 | -5.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |