C6H5O7-3 — CID 5459771
(1R,2S)-1-hydroxypropane-1,2,3-tricarboxylate (PubChem CID 5459771) has the molecular formula C6H5O7-3 and a molecular weight of 189.10 g/mol. Its IUPAC name is (1R,2S)-1-hydroxypropane-1,2,3-tricarboxylate.
| Compound Name | (1R,2S)-1-hydroxypropane-1,2,3-tricarboxylate |
|---|---|
| PubChem CID | 5459771 |
| Molecular Formula | C6H5O7-3 |
| Molecular Weight | 189.10 g/mol |
| Exact Mass | 189.01 |
| IUPAC Name | (1R,2S)-1-hydroxypropane-1,2,3-tricarboxylate |
| SMILES | O=C([O-])C[C@H](C(=O)[O-])[C@@H](O)C(=O)[O-] |
| InChI | InChI=1S/C6H8O7/c7-3(8)1-2(5(10)11)4(9)6(12)13/h2,4,9H,1H2,(H,7,8)(H,10,11)(H,12,13)/p-3/t2-,4+/m0/s1 |
| InChIKey | ODBLHEXUDAPZAU-ZAFYKAAXSA-K |
| XLogP | -5.40 |
| TPSA | 140.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.10 |
| LogP ≤ 5 | -5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |