C7H8Na2O7 — CID 24800401
disodium;2-(1-hydroxy-2-methoxy-2-oxoethyl)butanedioate (PubChem CID 24800401) has the molecular formula C7H8Na2O7 and a molecular weight of 250.11 g/mol. Its IUPAC name is disodium;2-(1-hydroxy-2-methoxy-2-oxoethyl)butanedioate.
| Compound Name | disodium;2-(1-hydroxy-2-methoxy-2-oxoethyl)butanedioate |
|---|---|
| PubChem CID | 24800401 |
| Molecular Formula | C7H8Na2O7 |
| Molecular Weight | 250.11 g/mol |
| Exact Mass | 250.01 |
| IUPAC Name | disodium;2-(1-hydroxy-2-methoxy-2-oxoethyl)butanedioate |
| SMILES | COC(=O)C(O)C(CC(=O)[O-])C(=O)[O-].[Na+].[Na+] |
| InChI | InChI=1S/C7H10O7.2Na/c1-14-7(13)5(10)3(6(11)12)2-4(8)9;;/h3,5,10H,2H2,1H3,(H,8,9)(H,11,12);;/q;2*+1/p-2 |
| InChIKey | YNPNJFDMEIDPKB-UHFFFAOYSA-L |
| XLogP | -9.97 |
| TPSA | 126.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.11 |
| LogP ≤ 5 | -9.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |