C11H10O5-2 — CID 6945466
(2R)-2-[(S)-hydroxy(phenyl)methyl]butanedioate (PubChem CID 6945466) has the molecular formula C11H10O5-2 and a molecular weight of 222.20 g/mol. Its IUPAC name is (2R)-2-[(S)-hydroxy(phenyl)methyl]butanedioate.
| Compound Name | (2R)-2-[(S)-hydroxy(phenyl)methyl]butanedioate |
|---|---|
| PubChem CID | 6945466 |
| Molecular Formula | C11H10O5-2 |
| Molecular Weight | 222.20 g/mol |
| Exact Mass | 222.05 |
| IUPAC Name | (2R)-2-[(S)-hydroxy(phenyl)methyl]butanedioate |
| SMILES | O=C([O-])C[C@@H](C(=O)[O-])[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C11H12O5/c12-9(13)6-8(11(15)16)10(14)7-4-2-1-3-5-7/h1-5,8,10,14H,6H2,(H,12,13)(H,15,16)/p-2/t8-,10-/m1/s1 |
| InChIKey | PEMSVVZWLJFHRI-PSASIEDQSA-L |
| XLogP | -1.77 |
| TPSA | 100.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.20 |
| LogP ≤ 5 | -1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |