C6H12N2O6 — CID 5088002
2,3-dihydroxy-N,N'-bis(hydroxymethyl)butanediamide (PubChem CID 5088002) has the molecular formula C6H12N2O6 and a molecular weight of 208.17 g/mol. Its IUPAC name is 2,3-dihydroxy-N,N'-bis(hydroxymethyl)butanediamide.
| Compound Name | 2,3-dihydroxy-N,N'-bis(hydroxymethyl)butanediamide |
|---|---|
| PubChem CID | 5088002 |
| Molecular Formula | C6H12N2O6 |
| Molecular Weight | 208.17 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | 2,3-dihydroxy-N,N'-bis(hydroxymethyl)butanediamide |
| SMILES | O=C(NCO)C(O)C(O)C(=O)NCO |
| InChI | InChI=1S/C6H12N2O6/c9-1-7-5(13)3(11)4(12)6(14)8-2-10/h3-4,9-12H,1-2H2,(H,7,13)(H,8,14) |
| InChIKey | ONTXEYIFYORDNL-UHFFFAOYSA-N |
| XLogP | -4.16 |
| TPSA | 139.12 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.17 |
| LogP ≤ 5 | -4.16 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|