C3H10N2O4 — CID 139703272
1,3-bis(hydroxymethyl)urea;hydrate (PubChem CID 139703272) has the molecular formula C3H10N2O4 and a molecular weight of 138.12 g/mol. Its IUPAC name is 1,3-bis(hydroxymethyl)urea;hydrate.
| Compound Name | 1,3-bis(hydroxymethyl)urea;hydrate |
|---|---|
| PubChem CID | 139703272 |
| Molecular Formula | C3H10N2O4 |
| Molecular Weight | 138.12 g/mol |
| Exact Mass | 138.06 |
| IUPAC Name | 1,3-bis(hydroxymethyl)urea;hydrate |
| SMILES | O.O=C(NCO)NCO |
| InChI | InChI=1S/C3H8N2O3.H2O/c6-1-4-3(8)5-2-7;/h6-7H,1-2H2,(H2,4,5,8);1H2 |
| InChIKey | NVTVMLOODCECCB-UHFFFAOYSA-N |
| XLogP | -2.64 |
| TPSA | 113.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.12 |
| LogP ≤ 5 | -2.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|