C9H24N2O8 — CID 161356873
1,3-bis(hydroxymethyl)urea;propane-1,2-diol;propane-1,2,3-triol (PubChem CID 161356873) has the molecular formula C9H24N2O8 and a molecular weight of 288.30 g/mol. Its IUPAC name is 1,3-bis(hydroxymethyl)urea;propane-1,2-diol;propane-1,2,3-triol.
| Compound Name | 1,3-bis(hydroxymethyl)urea;propane-1,2-diol;propane-1,2,3-triol |
|---|---|
| PubChem CID | 161356873 |
| Molecular Formula | C9H24N2O8 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | 1,3-bis(hydroxymethyl)urea;propane-1,2-diol;propane-1,2,3-triol |
| SMILES | CC(O)CO.O=C(NCO)NCO.OCC(O)CO |
| InChI | InChI=1S/C3H8N2O3.C3H8O3.C3H8O2/c6-1-4-3(8)5-2-7;4-1-3(6)2-5;1-3(5)2-4/h6-7H,1-2H2,(H2,4,5,8);3-6H,1-2H2;3-5H,2H2,1H3 |
| InChIKey | VOQWBPPMEVVJJG-UHFFFAOYSA-N |
| XLogP | -4.12 |
| TPSA | 182.74 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | -4.12 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|