C3H5Cl2NO2 — CID 12832764
2,2-dichloro-N-(hydroxymethyl)acetamide (PubChem CID 12832764) has the molecular formula C3H5Cl2NO2 and a molecular weight of 157.98 g/mol. Its IUPAC name is 2,2-dichloro-N-(hydroxymethyl)acetamide.
| Compound Name | 2,2-dichloro-N-(hydroxymethyl)acetamide |
|---|---|
| PubChem CID | 12832764 |
| Molecular Formula | C3H5Cl2NO2 |
| Molecular Weight | 157.98 g/mol |
| Exact Mass | 156.97 |
| IUPAC Name | 2,2-dichloro-N-(hydroxymethyl)acetamide |
| SMILES | O=C(NCO)C(Cl)Cl |
| InChI | InChI=1S/C3H5Cl2NO2/c4-2(5)3(8)6-1-7/h2,7H,1H2,(H,6,8) |
| InChIKey | VBYMXUAVVUKICP-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.98 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|