C2H3Cl2NO2 — CID 59715454
2,2-dichloro-N-hydroxyacetamide (PubChem CID 59715454) has the molecular formula C2H3Cl2NO2 and a molecular weight of 143.96 g/mol. Its IUPAC name is 2,2-dichloro-N-hydroxyacetamide.
| Compound Name | 2,2-dichloro-N-hydroxyacetamide |
|---|---|
| PubChem CID | 59715454 |
| Molecular Formula | C2H3Cl2NO2 |
| Molecular Weight | 143.96 g/mol |
| Exact Mass | 142.95 |
| IUPAC Name | 2,2-dichloro-N-hydroxyacetamide |
| SMILES | O=C(NO)C(Cl)Cl |
| InChI | InChI=1S/C2H3Cl2NO2/c3-1(4)2(6)5-7/h1,7H,(H,5,6) |
| InChIKey | TWAKPFWFSAPFFQ-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.96 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|