C6H12Cl2N2O — CID 174663209
2,2-dichloro-N',N'-diethylacetohydrazide (PubChem CID 174663209) has the molecular formula C6H12Cl2N2O and a molecular weight of 199.08 g/mol. Its IUPAC name is 2,2-dichloro-N',N'-diethylacetohydrazide.
| Compound Name | 2,2-dichloro-N',N'-diethylacetohydrazide |
|---|---|
| PubChem CID | 174663209 |
| Molecular Formula | C6H12Cl2N2O |
| Molecular Weight | 199.08 g/mol |
| Exact Mass | 198.03 |
| IUPAC Name | 2,2-dichloro-N',N'-diethylacetohydrazide |
| SMILES | CCN(CC)NC(=O)C(Cl)Cl |
| InChI | InChI=1S/C6H12Cl2N2O/c1-3-10(4-2)9-6(11)5(7)8/h5H,3-4H2,1-2H3,(H,9,11) |
| InChIKey | MJBKLKONCPSQLE-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.08 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|