About 2,2-dichloro-N',N'-diethylacetohydrazide
2,2-dichloro-N',N'-diethylacetohydrazide (PubChem CID 174663209) has the molecular formula C6H12Cl2N2O
and a molecular weight of 199.08 g/mol. Its IUPAC name is 2,2-dichloro-N',N'-diethylacetohydrazide.
Molecular Properties
| Compound Name | 2,2-dichloro-N',N'-diethylacetohydrazide |
| PubChem CID | 174663209 |
| Molecular Formula | C6H12Cl2N2O |
| Molecular Weight | 199.08 g/mol |
| Exact Mass | 198.03 |
| IUPAC Name | 2,2-dichloro-N',N'-diethylacetohydrazide |
| SMILES | CCN(CC)NC(=O)C(Cl)Cl |
| InChI | InChI=1S/C6H12Cl2N2O/c1-3-10(4-2)9-6(11)5(7)8/h5H,3-4H2,1-2H3,(H,9,11) |
| InChIKey | MJBKLKONCPSQLE-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.08 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2,2-dichloro-N',N'-diethylacetohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dichloro-N',N'-diethylacetohydrazide?
The IUPAC name of 2,2-dichloro-N',N'-diethylacetohydrazide (CID 174663209) is 2,2-dichloro-N',N'-diethylacetohydrazide.
What is the SMILES notation for 2,2-dichloro-N',N'-diethylacetohydrazide?
The canonical SMILES for 2,2-dichloro-N',N'-diethylacetohydrazide is CCN(CC)NC(=O)C(Cl)Cl.
What is the InChIKey of 2,2-dichloro-N',N'-diethylacetohydrazide?
The InChIKey is MJBKLKONCPSQLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12Cl2N2O/c1-3-10(4-2)9-6(11)5(7)8/h5H,3-4H2,1-2H3,(H,9,11).
What are the key properties of 2,2-dichloro-N',N'-diethylacetohydrazide?
2,2-dichloro-N',N'-diethylacetohydrazide has a molecular weight of 199.08 g/mol, XLogP of 1.16, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dichloro-N',N'-diethylacetohydrazide is sourced from PubChem (CID 174663209), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).