C20H42N2O — CID 141450549
N',N'-diethylhexadecanehydrazide (PubChem CID 141450549) has the molecular formula C20H42N2O and a molecular weight of 326.57 g/mol. Its IUPAC name is N',N'-diethylhexadecanehydrazide.
| Compound Name | N',N'-diethylhexadecanehydrazide |
|---|---|
| PubChem CID | 141450549 |
| Molecular Formula | C20H42N2O |
| Molecular Weight | 326.57 g/mol |
| Exact Mass | 326.33 |
| IUPAC Name | N',N'-diethylhexadecanehydrazide |
| SMILES | CCCCCCCCCCCCCCCC(=O)NN(CC)CC |
| InChI | InChI=1S/C20H42N2O/c1-4-7-8-9-10-11-12-13-14-15-16-17-18-19-20(23)21-22(5-2)6-3/h4-19H2,1-3H3,(H,21,23) |
| InChIKey | UIWVYVPKMCWSAD-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.57 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|