About N'-(2-hydroxyethyl)-N'-propylhexadecanehydrazide
N'-(2-hydroxyethyl)-N'-propylhexadecanehydrazide (PubChem CID 175534170) has the molecular formula C21H44N2O2
and a molecular weight of 356.60 g/mol. Its IUPAC name is N'-(2-hydroxyethyl)-N'-propylhexadecanehydrazide.
Molecular Properties
| Compound Name | N'-(2-hydroxyethyl)-N'-propylhexadecanehydrazide |
| PubChem CID | 175534170 |
| Molecular Formula | C21H44N2O2 |
| Molecular Weight | 356.60 g/mol |
| Exact Mass | 356.34 |
| IUPAC Name | N'-(2-hydroxyethyl)-N'-propylhexadecanehydrazide |
| SMILES | CCCCCCCCCCCCCCCC(=O)NN(CCC)CCO |
| InChI | InChI=1S/C21H44N2O2/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-21(25)22-23(18-4-2)19-20-24/h24H,3-20H2,1-2H3,(H,22,25) |
| InChIKey | LSZVEYSCRSWSSU-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 356.60 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-(2-hydroxyethyl)-N'-propylhexadecanehydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(2-hydroxyethyl)-N'-propylhexadecanehydrazide?
The IUPAC name of N'-(2-hydroxyethyl)-N'-propylhexadecanehydrazide (CID 175534170) is N'-(2-hydroxyethyl)-N'-propylhexadecanehydrazide.
What is the SMILES notation for N'-(2-hydroxyethyl)-N'-propylhexadecanehydrazide?
The canonical SMILES for N'-(2-hydroxyethyl)-N'-propylhexadecanehydrazide is CCCCCCCCCCCCCCCC(=O)NN(CCC)CCO.
What is the InChIKey of N'-(2-hydroxyethyl)-N'-propylhexadecanehydrazide?
The InChIKey is LSZVEYSCRSWSSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H44N2O2/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-21(25)22-23(18-4-2)19-20-24/h24H,3-20H2,1-2H3,(H,22,25).
What are the key properties of N'-(2-hydroxyethyl)-N'-propylhexadecanehydrazide?
N'-(2-hydroxyethyl)-N'-propylhexadecanehydrazide has a molecular weight of 356.60 g/mol, XLogP of 5.20, 19 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(2-hydroxyethyl)-N'-propylhexadecanehydrazide is sourced from PubChem (CID 175534170), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).