About N'-(2-hydroxyethyl)-N'-methyldodecanehydrazide
N'-(2-hydroxyethyl)-N'-methyldodecanehydrazide (PubChem CID 175333328) has the molecular formula C15H32N2O2
and a molecular weight of 272.43 g/mol. Its IUPAC name is N'-(2-hydroxyethyl)-N'-methyldodecanehydrazide.
Molecular Properties
| Compound Name | N'-(2-hydroxyethyl)-N'-methyldodecanehydrazide |
| PubChem CID | 175333328 |
| Molecular Formula | C15H32N2O2 |
| Molecular Weight | 272.43 g/mol |
| Exact Mass | 272.25 |
| IUPAC Name | N'-(2-hydroxyethyl)-N'-methyldodecanehydrazide |
| SMILES | CCCCCCCCCCCC(=O)NN(C)CCO |
| InChI | InChI=1S/C15H32N2O2/c1-3-4-5-6-7-8-9-10-11-12-15(19)16-17(2)13-14-18/h18H,3-14H2,1-2H3,(H,16,19) |
| InChIKey | JEGIIEBVAMOYFM-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.43 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-(2-hydroxyethyl)-N'-methyldodecanehydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(2-hydroxyethyl)-N'-methyldodecanehydrazide?
The IUPAC name of N'-(2-hydroxyethyl)-N'-methyldodecanehydrazide (CID 175333328) is N'-(2-hydroxyethyl)-N'-methyldodecanehydrazide.
What is the SMILES notation for N'-(2-hydroxyethyl)-N'-methyldodecanehydrazide?
The canonical SMILES for N'-(2-hydroxyethyl)-N'-methyldodecanehydrazide is CCCCCCCCCCCC(=O)NN(C)CCO.
What is the InChIKey of N'-(2-hydroxyethyl)-N'-methyldodecanehydrazide?
The InChIKey is JEGIIEBVAMOYFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H32N2O2/c1-3-4-5-6-7-8-9-10-11-12-15(19)16-17(2)13-14-18/h18H,3-14H2,1-2H3,(H,16,19).
What are the key properties of N'-(2-hydroxyethyl)-N'-methyldodecanehydrazide?
N'-(2-hydroxyethyl)-N'-methyldodecanehydrazide has a molecular weight of 272.43 g/mol, XLogP of 2.86, 13 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(2-hydroxyethyl)-N'-methyldodecanehydrazide is sourced from PubChem (CID 175333328), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).