C22H44N2O — CID 88708454
(Z)-N',N'-diethyloctadec-9-enehydrazide (PubChem CID 88708454) has the molecular formula C22H44N2O and a molecular weight of 352.61 g/mol. Its IUPAC name is (Z)-N',N'-diethyloctadec-9-enehydrazide.
| Compound Name | (Z)-N',N'-diethyloctadec-9-enehydrazide |
|---|---|
| PubChem CID | 88708454 |
| Molecular Formula | C22H44N2O |
| Molecular Weight | 352.61 g/mol |
| Exact Mass | 352.35 |
| IUPAC Name | (Z)-N',N'-diethyloctadec-9-enehydrazide |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)NN(CC)CC |
| InChI | InChI=1S/C22H44N2O/c1-4-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(25)23-24(5-2)6-3/h13-14H,4-12,15-21H2,1-3H3,(H,23,25)/b14-13- |
| InChIKey | VHPZZUDLPODBAG-YPKPFQOOSA-N |
| XLogP | 6.40 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.61 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|