C37H68N2O2S — CID 173415612
N-(octadec-9-enoylcarbamothioyl)octadec-9-enamide (PubChem CID 173415612) has the molecular formula C37H68N2O2S and a molecular weight of 605.03 g/mol. Its IUPAC name is N-(octadec-9-enoylcarbamothioyl)octadec-9-enamide.
| Compound Name | N-(octadec-9-enoylcarbamothioyl)octadec-9-enamide |
|---|---|
| PubChem CID | 173415612 |
| Molecular Formula | C37H68N2O2S |
| Molecular Weight | 605.03 g/mol |
| Exact Mass | 604.50 |
| IUPAC Name | N-(octadec-9-enoylcarbamothioyl)octadec-9-enamide |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)NC(=S)NC(=O)CCCCCCCC=CCCCCCCCC |
| InChI | InChI=1S/C37H68N2O2S/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35(40)38-37(42)39-36(41)34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h17-20H,3-16,21-34H2,1-2H3,(H2,38,39,40,41,42) |
| InChIKey | FNRNQTNNRAEQJJ-UHFFFAOYSA-N |
| XLogP | 11.58 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.03 |
| LogP ≤ 5 | 11.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|