About N-(hydroxymethyl)carbamoyl chloride;hydrate
N-(hydroxymethyl)carbamoyl chloride;hydrate (PubChem CID 173432235) has the molecular formula C2H6ClNO3
and a molecular weight of 127.53 g/mol. Its IUPAC name is N-(hydroxymethyl)carbamoyl chloride;hydrate.
Molecular Properties
| Compound Name | N-(hydroxymethyl)carbamoyl chloride;hydrate |
| PubChem CID | 173432235 |
| Molecular Formula | C2H6ClNO3 |
| Molecular Weight | 127.53 g/mol |
| Exact Mass | 127.00 |
| IUPAC Name | N-(hydroxymethyl)carbamoyl chloride;hydrate |
| SMILES | O.O=C(Cl)NCO |
| InChI | InChI=1S/C2H4ClNO2.H2O/c3-2(6)4-1-5;/h5H,1H2,(H,4,6);1H2 |
| InChIKey | GGQMTUPDFBGOIO-UHFFFAOYSA-N |
| XLogP | -0.94 |
| TPSA | 80.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.53 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze N-(hydroxymethyl)carbamoyl chloride;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(hydroxymethyl)carbamoyl chloride;hydrate?
The IUPAC name of N-(hydroxymethyl)carbamoyl chloride;hydrate (CID 173432235) is N-(hydroxymethyl)carbamoyl chloride;hydrate.
What is the SMILES notation for N-(hydroxymethyl)carbamoyl chloride;hydrate?
The canonical SMILES for N-(hydroxymethyl)carbamoyl chloride;hydrate is O.O=C(Cl)NCO.
What is the InChIKey of N-(hydroxymethyl)carbamoyl chloride;hydrate?
The InChIKey is GGQMTUPDFBGOIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H4ClNO2.H2O/c3-2(6)4-1-5;/h5H,1H2,(H,4,6);1H2.
What are the key properties of N-(hydroxymethyl)carbamoyl chloride;hydrate?
N-(hydroxymethyl)carbamoyl chloride;hydrate has a molecular weight of 127.53 g/mol, XLogP of -0.94, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(hydroxymethyl)carbamoyl chloride;hydrate is sourced from PubChem (CID 173432235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).