(hydroxymethylamino)carbamic acid

C2H6N2O3 — CID 151690264

IUPAC(hydroxymethylamino)carbamic acid
SMILESO=C(O)NNCO
InChIInChI=1S/C2H6N2O3/c5-1-3-4-2(6)7/h3-5H,1H2,(H,6,7)
InChIKeyRCKGXBLOJFLKPR-UHFFFAOYSA-N
MW106.08 g/mol
LogP-1.29
Rot. Bonds2

About (hydroxymethylamino)carbamic acid

(hydroxymethylamino)carbamic acid (PubChem CID 151690264) has the molecular formula C2H6N2O3 and a molecular weight of 106.08 g/mol. Its IUPAC name is (hydroxymethylamino)carbamic acid.

Molecular Properties

Compound Name(hydroxymethylamino)carbamic acid
PubChem CID151690264
Molecular FormulaC2H6N2O3
Molecular Weight106.08 g/mol
Exact Mass106.04
IUPAC Name(hydroxymethylamino)carbamic acid
SMILESO=C(O)NNCO
InChIInChI=1S/C2H6N2O3/c5-1-3-4-2(6)7/h3-5H,1H2,(H,6,7)
InChIKeyRCKGXBLOJFLKPR-UHFFFAOYSA-N
XLogP-1.29
TPSA81.59 Ų
H-Bond Donors4
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms7
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500106.08
LogP ≤ 5-1.29
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze (hydroxymethylamino)carbamic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (hydroxymethylamino)carbamic acid?
The IUPAC name of (hydroxymethylamino)carbamic acid (CID 151690264) is (hydroxymethylamino)carbamic acid.
What is the SMILES notation for (hydroxymethylamino)carbamic acid?
The canonical SMILES for (hydroxymethylamino)carbamic acid is O=C(O)NNCO.
What is the InChIKey of (hydroxymethylamino)carbamic acid?
The InChIKey is RCKGXBLOJFLKPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H6N2O3/c5-1-3-4-2(6)7/h3-5H,1H2,(H,6,7).
What are the key properties of (hydroxymethylamino)carbamic acid?
(hydroxymethylamino)carbamic acid has a molecular weight of 106.08 g/mol, XLogP of -1.29, 2 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (hydroxymethylamino)carbamic acid is sourced from PubChem (CID 151690264), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).