C8H10N8O6 — CID 18795336
2-[[4-[(2-azido-2-oxoethyl)amino]-2,3-dihydroxy-4-oxobutanoyl]amino]acetyl azide (PubChem CID 18795336) has the molecular formula C8H10N8O6 and a molecular weight of 314.22 g/mol. Its IUPAC name is 2-[[4-[(2-azido-2-oxoethyl)amino]-2,3-dihydroxy-4-oxobutanoyl]amino]acetyl azide.
| Compound Name | 2-[[4-[(2-azido-2-oxoethyl)amino]-2,3-dihydroxy-4-oxobutanoyl]amino]acetyl azide |
|---|---|
| PubChem CID | 18795336 |
| Molecular Formula | C8H10N8O6 |
| Molecular Weight | 314.22 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | 2-[[4-[(2-azido-2-oxoethyl)amino]-2,3-dihydroxy-4-oxobutanoyl]amino]acetyl azide |
| SMILES | [N-]=[N+]=NC(=O)CNC(=O)C(O)C(O)C(=O)NCC(=O)N=[N+]=[N-] |
| InChI | InChI=1S/C8H10N8O6/c9-15-13-3(17)1-11-7(21)5(19)6(20)8(22)12-2-4(18)14-16-10/h5-6,19-20H,1-2H2,(H,11,21)(H,12,22) |
| InChIKey | MKUQGYURTHZOCW-UHFFFAOYSA-N |
| XLogP | -2.39 |
| TPSA | 230.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.22 |
| LogP ≤ 5 | -2.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|