C6H11N3O5 — CID 169205481
(2S,3S,4R,5R)-2,3,4,5-tetrahydroxyhexanoyl azide (PubChem CID 169205481) has the molecular formula C6H11N3O5 and a molecular weight of 205.17 g/mol. Its IUPAC name is (2S,3S,4R,5R)-2,3,4,5-tetrahydroxyhexanoyl azide.
| Compound Name | (2S,3S,4R,5R)-2,3,4,5-tetrahydroxyhexanoyl azide |
|---|---|
| PubChem CID | 169205481 |
| Molecular Formula | C6H11N3O5 |
| Molecular Weight | 205.17 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | (2S,3S,4R,5R)-2,3,4,5-tetrahydroxyhexanoyl azide |
| SMILES | C[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)C(=O)N=[N+]=[N-] |
| InChI | InChI=1S/C6H11N3O5/c1-2(10)3(11)4(12)5(13)6(14)8-9-7/h2-5,10-13H,1H3/t2-,3-,4+,5+/m1/s1 |
| InChIKey | XLIBXVGJEKMHNN-MBMOQRBOSA-N |
| XLogP | -1.71 |
| TPSA | 146.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.17 |
| LogP ≤ 5 | -1.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|