C8H15N3O5 — CID 175461234
1-azido-4,5,6,7-tetrahydroxyoctan-3-one (PubChem CID 175461234) has the molecular formula C8H15N3O5 and a molecular weight of 233.22 g/mol. Its IUPAC name is 1-azido-4,5,6,7-tetrahydroxyoctan-3-one.
| Compound Name | 1-azido-4,5,6,7-tetrahydroxyoctan-3-one |
|---|---|
| PubChem CID | 175461234 |
| Molecular Formula | C8H15N3O5 |
| Molecular Weight | 233.22 g/mol |
| Exact Mass | 233.10 |
| IUPAC Name | 1-azido-4,5,6,7-tetrahydroxyoctan-3-one |
| SMILES | CC(O)C(O)C(O)C(O)C(=O)CCN=[N+]=[N-] |
| InChI | InChI=1S/C8H15N3O5/c1-4(12)6(14)8(16)7(15)5(13)2-3-10-11-9/h4,6-8,12,14-16H,2-3H2,1H3 |
| InChIKey | VVBXTJMJQXIYCP-UHFFFAOYSA-N |
| XLogP | -1.28 |
| TPSA | 146.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.22 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|