C9H17N3O6 — CID 141205114
(5R,6S,7R,8R)-1-azido-5,6,7,8,9-pentahydroxynonan-4-one (PubChem CID 141205114) has the molecular formula C9H17N3O6 and a molecular weight of 263.25 g/mol. Its IUPAC name is (5R,6S,7R,8R)-1-azido-5,6,7,8,9-pentahydroxynonan-4-one.
| Compound Name | (5R,6S,7R,8R)-1-azido-5,6,7,8,9-pentahydroxynonan-4-one |
|---|---|
| PubChem CID | 141205114 |
| Molecular Formula | C9H17N3O6 |
| Molecular Weight | 263.25 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | (5R,6S,7R,8R)-1-azido-5,6,7,8,9-pentahydroxynonan-4-one |
| SMILES | [N-]=[N+]=NCCCC(=O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C9H17N3O6/c10-12-11-3-1-2-5(14)7(16)9(18)8(17)6(15)4-13/h6-9,13,15-18H,1-4H2/t6-,7+,8-,9-/m1/s1 |
| InChIKey | OYHULAKCJXXZLR-BZNPZCIMSA-N |
| XLogP | -1.92 |
| TPSA | 166.98 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.25 |
| LogP ≤ 5 | -1.92 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|