About 5-azido-1,1-dihydroxypentan-2-one
5-azido-1,1-dihydroxypentan-2-one (PubChem CID 151328078) has the molecular formula C5H9N3O3
and a molecular weight of 159.15 g/mol. Its IUPAC name is 5-azido-1,1-dihydroxypentan-2-one.
Molecular Properties
| Compound Name | 5-azido-1,1-dihydroxypentan-2-one |
| PubChem CID | 151328078 |
| Molecular Formula | C5H9N3O3 |
| Molecular Weight | 159.15 g/mol |
| Exact Mass | 159.06 |
| IUPAC Name | 5-azido-1,1-dihydroxypentan-2-one |
| SMILES | [N-]=[N+]=NCCCC(=O)C(O)O |
| InChI | InChI=1S/C5H9N3O3/c6-8-7-3-1-2-4(9)5(10)11/h5,10-11H,1-3H2 |
| InChIKey | OHWDEWVBLUSUNS-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 106.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.15 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 5-azido-1,1-dihydroxypentan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-azido-1,1-dihydroxypentan-2-one?
The IUPAC name of 5-azido-1,1-dihydroxypentan-2-one (CID 151328078) is 5-azido-1,1-dihydroxypentan-2-one.
What is the SMILES notation for 5-azido-1,1-dihydroxypentan-2-one?
The canonical SMILES for 5-azido-1,1-dihydroxypentan-2-one is [N-]=[N+]=NCCCC(=O)C(O)O.
What is the InChIKey of 5-azido-1,1-dihydroxypentan-2-one?
The InChIKey is OHWDEWVBLUSUNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9N3O3/c6-8-7-3-1-2-4(9)5(10)11/h5,10-11H,1-3H2.
What are the key properties of 5-azido-1,1-dihydroxypentan-2-one?
5-azido-1,1-dihydroxypentan-2-one has a molecular weight of 159.15 g/mol, XLogP of -0.04, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-azido-1,1-dihydroxypentan-2-one is sourced from PubChem (CID 151328078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).