C6H12N3O7P — CID 154070621
(6-azido-3,4,5-trihydroxy-2-oxohexyl)phosphonic acid (PubChem CID 154070621) has the molecular formula C6H12N3O7P and a molecular weight of 269.15 g/mol. Its IUPAC name is (6-azido-3,4,5-trihydroxy-2-oxohexyl)phosphonic acid.
| Compound Name | (6-azido-3,4,5-trihydroxy-2-oxohexyl)phosphonic acid |
|---|---|
| PubChem CID | 154070621 |
| Molecular Formula | C6H12N3O7P |
| Molecular Weight | 269.15 g/mol |
| Exact Mass | 269.04 |
| IUPAC Name | (6-azido-3,4,5-trihydroxy-2-oxohexyl)phosphonic acid |
| SMILES | [N-]=[N+]=NCC(O)C(O)C(O)C(=O)CP(=O)(O)O |
| InChI | InChI=1S/C6H12N3O7P/c7-9-8-1-3(10)5(12)6(13)4(11)2-17(14,15)16/h3,5-6,10,12-13H,1-2H2,(H2,14,15,16) |
| InChIKey | ZLVLFZDTSVDWEA-UHFFFAOYSA-N |
| XLogP | -1.87 |
| TPSA | 184.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.15 |
| LogP ≤ 5 | -1.87 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|