C5H11N3O3 — CID 90777098
5-azidopentane-1,2,4-triol (PubChem CID 90777098) has the molecular formula C5H11N3O3 and a molecular weight of 161.16 g/mol. Its IUPAC name is 5-azidopentane-1,2,4-triol.
| Compound Name | 5-azidopentane-1,2,4-triol |
|---|---|
| PubChem CID | 90777098 |
| Molecular Formula | C5H11N3O3 |
| Molecular Weight | 161.16 g/mol |
| Exact Mass | 161.08 |
| IUPAC Name | 5-azidopentane-1,2,4-triol |
| SMILES | [N-]=[N+]=NCC(O)CC(O)CO |
| InChI | InChI=1S/C5H11N3O3/c6-8-7-2-4(10)1-5(11)3-9/h4-5,9-11H,1-3H2 |
| InChIKey | BOZMXLQQBFYDJG-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 109.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.16 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|